1,2-O-Ethylidene-β-D-mannopyranose [CAS 230953-16-9]

1,2-O-Ethylidene-β-D-mannopyranose is a class of biochemical reagents used in glycobiology research. Glycobiology studies the structure, synthesis, biology, and evolution of sugars. It involves carbohydrate chemistry, enzymology of glycan formation and degradation, protein-glycan recognition, and the role of glycans in biological systems. This field is closely related to basic research, biomedicine, and biotechnology[1].

[230953-16-9]

C8H14O6

206.19

O[C@@H]1[C@@]2([H])[C@@](OC(O2)C)([H])O[C@@H]([C@H]1O)CO

Biochemical Assay Reagents

Room temperature