1,2-O-Ethylidene-β-D-mannopyranoside triacetate [CAS 630102-81-7]

1,2-O-Ethylidene-β-D-mannopyranoside triacetate is a class of biochemical reagents used in glycobiology research. Glycobiology studies the structure, synthesis, biology, and evolution of sugars. It involves carbohydrate chemistry, enzymology of glycan formation and degradation, protein-glycan recognition, and the role of glycans in biological systems. This field is closely related to basic research, biomedicine, and biotechnology[1].

[630102-81-7]

C14H20O9

332.3

CC(O[C@@H]1[C@@]2([H])[C@@](OC(O2)C)([H])O[C@@H]([C@H]1OC(C)=O)COC(C)=O)=O

Biochemical Assay Reagents

Room temperature