Δ2-Avermectin B1a [CAS 110415-68-4]

Δ²-Avermectin B₁ₐ (Compound 3) is an antiparasitic agent targeting glutamate-gated chloride channels (GluCls) in the neuromuscular system of invertebrates. Δ²-Avermectin B₁ₐ enhances chloride ion influx, leading to hyperpolarization of the neuromuscular cell membrane, inhibition of neural signal transmission, and ultimately paralysis and death of parasites. Δ²-Avermectin B₁ₐ is promising for research of agricultural pests[1].

[110415-68-4]

C48H72O14

873.08

C/C([C@H]([C@H](/C=C/C=C1[C@]2(C3=C[C@@H]([C@H]([C@]2(OC/1)[H])O)C)O)C)O[C@]4(C[C@@H]([C@H]([C@@H](O4)C)O[C@@]5(O[C@H]([C@@H]([C@H](C5)OC)O)C)[H])OC)[H])=C\C[C@@]6(C[C@@]([H])(C[C@@]7(O6)C=C[C@@H]([C@]([H])(O7)[C@H](CC)C)C)OC3=O)[H]

Chloride Channel; Parasite

Room temperature