2- (Cyclohexylmethyl) -plumbagin [CAS 3033734-59-4]

2- (Cyclohexylmethyl) -plumbagin is a derivative of the naphthoquinone compound Plumbagin. Under nutrient-deprived conditions, 2- (Cyclohexylmethyl) -plumbagin selectively exhibits cytotoxicity against PANC-1 human pancreatic cancer cells (PC50 = 0.11 µM) and reduces the phosphorylation of Akt and mTOR in PANC-1 cells. 2- (Cyclohexylmethyl) -plumbagin also induces apoptosis (Apoptosis) in PANC-1 cells at a concentration of 1 µM. Additionally, 2- (Cyclohexylmethyl) -plumbagin reduces tumor volume and weight in a xenograft MiaPaCa-2 pancreatic cancer mouse model[1].

[3033734-59-4]

C17H18O3

270.32

O=C1C=C(CC2CCCCC2)C(C3=C1C(O)=CC=C3)=O

Apoptosis; Drug Derivative

Room temperature