4-O-β-D-Galactopyranosyl-D-galactopyranose [CAS 2152-98-9]

4-O-β-D-Galactopyranosyl-D-galactopyranose is a class of biochemical reagents used in glycobiology research. Glycobiology studies the structure, synthesis, biology, and evolution of sugars. It involves carbohydrate chemistry, enzymology of glycan formation and degradation, protein-glycan recognition, and the role of glycans in biological systems. This field is closely related to basic research, biomedicine, and biotechnology[1].

[2152-98-9]

C12H22O11

342.3

OC[C@@H](OC([C@@H]([C@H]1O)O)O)[C@@H]1O[C@@H]2O[C@@H]([C@@H]([C@@H]([C@H]2O)O)O)CO

Biochemical Assay Reagents

Room temperature