5-Nitro BAPTA [CAS 124251-83-8]

5-Nitro BAPTA is a calcium chelator, combinded with 2-Me-substituted TM (as a fluorescent moiety), can be used to form a red fluorescent probe (CaTM-2 AM), for imaging of cytoplasmic Ca2+ in cultured living cells. 5-Nitro BAPTA is a building block used in the synthesis of Ca2+ specific chelators, Ca2+ buffers, and fluorescent Ca2+ indicators[1][2].

[124251-83-8]

C22H23N3O12

521.43

O=C(O)CN(C1=CC=CC=C1OCCOC2=CC([N+]([O-])=O)=CC=C2N(CC(O)=O)CC(O)=O)CC(O)=O

Fluorescent Dye

10 mM in DMSO

Room temperature