6-α-D-Glucopyranosyl maltotriose [CAS 35175-16-7]

6-α-D-Glucopyranosyl maltotriose is a class of biochemical reagents used in glycobiology research. Glycobiology studies the structure, synthesis, biology, and evolution of sugars. It involves carbohydrate chemistry, enzymology of glycan formation and degradation, protein-glycan recognition, and the role of glycans in biological systems. This field is closely related to basic research, biomedicine, and biotechnology[1].

[35175-16-7]

C24H42O21

666.58

OC[C@@H](O[C@@H]([C@@H]([C@H]1O)O)O[C@H]([C@H](O)CO)[C@H](O)[C@@H](O)C=O)[C@H]1O[C@H]2O[C@@H]([C@H]([C@@H]([C@H]2O)O)O)CO[C@H]3O[C@@H]([C@H]([C@@H]([C@H]3O)O)O)CO

Biochemical Assay Reagents

Room temperature