ABEI [CAS 66612-29-1]

ABEI (4-Acetamido-4'-isothiocyanatostilbene-2,2'-disulfonic acid) is a compound belonging to the class of fluorescent dyes. It is commonly used as a labeling reagent in biochemistry and molecular biology to detect and quantify proteins and other biomolecules. ABEI can be attached to the amino groups of proteins or peptides and will generate a strong fluorescent signal when excited by light of a specific wavelength. This allows the detection and quantification of proteins and other biomolecules in biological samples such as blood or tissue samples.

[66612-29-1]

C14H20N4O2

276.33

O=C1NNC(C2=C1C=C(N(CCCCN)CC)C=C2)=O

Biochemical Assay Reagents

99.26

Acetic acid : 25 mg/mL (ultrasonic) |H2O : 1.92 mg/mL (ultrasonic; adjust pH to 10 with 1 M NaOH)

-20°C, 3 years; 4°C, 2 years (Powder)

Room Temperature

H315, H319

H315, H319