AF488 azide

AF488 azide is a fluorescent dye that can be used to determine the reactivity of immobilized DIBO groups. It contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. AF488 exhibits the λem and λex wavelength of 520 nm and 470 nm, respectively[1][2].

C24H18K2N6O10S2

692.76

O=C(C1=C(C2=C(C=CC(N)=C3S(=O)(O[K])=O)C3=[O+]C4=C2C=CC(N)=C4S(=O)([O-])=O)C=CC(C(NCCCN=[N+]=[N-])=O)=C1)O[K]

Fluorescent Dye

99

10 mM in DMSO

-20°C (Powder, protect from light)

Blue Ice

H302, H315, H319, H335

H302, H315, H319, H335