Anti-MRSA agent 38

Anti-MRSA agent 38 is a broad-spectrum antibacterial agent (MIC = 0.0625-2 µg/mL) . Anti-MRSA agent 38 can inhibit ribosomal protein synthesis. Anti-MRSA agent 38 exerts multiple bactericidal effects by disrupting bacterial membrane structure and inducing ROS accumulation. Anti-MRSA agent 38 can selectively kill tumor cells, such as HGC-27 (IC50 = 0.86 µM), MRC-5 (IC50 = 5.52 µM), and RPC (IC50 = 6.09 µM) cells. Anti-MRSA agent 38 can be used to study infectious diseases such as bacterial infection[1].

C51H69F6NO5P2S

984.1

C=C[C@@]1(C[C@H]([C@](C)([C@H](C)CC2)[C@@H]3C(CC[C@@]32[C@H]([C@@H]1O)C)=O)OC(CSC(C)(CNC(CCCCCC[P+](C4=CC=CC=C4)(C5=CC=CC=C5)C6=CC=CC=C6)=O)C)=O)C.F[P-](F)(F)(F)(F)F

Bacterial; Reactive Oxygen Species (ROS)

Room temperature