Antibacterial agent 271

Antibacterial agent 271 is an antibacterial agent with significant inhibition against Escherichia coli (MIC: 2.2 μM) . Antibacterial agent 271 reduces metabolic activity by disrupting the integrity of bacterial membranes. Antibacterial agent 271 binds to DNA grooves to inhibit replication and induces accumulation of reactive oxygen species (ROS), ultimately leading to bacterial death. Antibacterial agent 271 shows significant potential in combating bacterial infections[1].

C20H17N5O6S

455.44

NC1=CC=C(S(=O)(NC2=CC=C(C(CN3C(C)=NC=C3[N+]([O-])=O)=CC(O4)=O)C4=C2)=O)C=C1

Bacterial; DNA/RNA Synthesis; Reactive Oxygen Species (ROS)

Room temperature