Antifungal agent 117 [CAS 9007-83-4]

Antifungal agent 117 is a bis-pyrazole carboxamide derivative with antifungal activity, exhibiting an EC50 value of 11.58 mg/L against Sclerotinia sclerotiorum. Antifungal agent 117 increases cell membrane permeability, causing an imbalance in osmotic pressure inside and outside the cell, and induces the accumulation of reactive oxygen species (ROS), leading to oxidative damage to the cell membrane, resulting in leakage of cellular contents and eventually cell death. RNA sequencing analysis reveals that Antifungal agent 117 downregulates catalase genes and upregulates neutral ceramidase genes, disrupting cell membrane structure, accelerating sphingolipid metabolism, and promoting cell death. Antifungal agent 117 shows great potential in the fields of plant protection and antifungal infection[1].

[9007-83-4]

C18H16ClF2N5O3

423.8

ClC1=CC=C(C=C1)N2N=CC(C(OCC)=O)=C2NC(C3=CN(C)N=C3C(F)F)=O

Fungal

Room temperature