Antifungal agent 134 [CAS 3080992-04-4]

Antifungal agent 134 (Compound B13) is an antifungal agent with EC50s of 3.24, 1.89, 1.70, 0.36, 4.27, and 1.50 μg/mL for Botrytis cinerea, Alternaria solani, Fusarium graminearum, Rhizoctonia solani, Colletotrichum orbiculare, and Alternaria alternata, respectively. Antifungal agent 134 can disrupt the cell membrane and mitochondria of the hyphae, leading to significant ROS accumulation. Antifungal agent 134 also has significant herbicidal activities against field weeds, such as Amaranthus retroflexus L and Abutilon theophrasti Medicus. Antifungal agent 134 can be used for crop diseases and field weeds research[1].

[3080992-04-4]

C18H12F4N2O4

396.29

O=C(NNC1=CC=C(F)C=C1)COC2=CC(O3)=C(C=C2)C(C(F)(F)F)=CC3=O

Fungal; Herbicide; Reactive Oxygen Species (ROS)

Room temperature