ART899 [CAS 2607139-85-3]

ART899 is a highly specific allosteric inhibitor of the Polθ DNA polymerase domain. ART899 can effectively enhance the radiosensitivity of tumor cells, shows good tolerance when combined with fractionated radiation, and significantly reduces tumor growth compared to radiation alone[1].

[2607139-85-3]

C19H13D3ClF4N3O4

464.81

[2H]C([2H])([2H])N(C1=CC(Cl)=C(C=C1)F)C([C@H]2N(C3=CC(C(F)(F)F)=CC(C)=N3)C([C@H]([C@H]2O)O)=O)=O

DNA/RNA Synthesis

-20°C, 3 years; 4°C, 2 years (Powder)

Room Temperature