AS2795440 [CAS 2171506-45-7]

AS2795440 is a PIKfyve inhibitor. AS2795440 selectively inhibits proinflammatory cytokine such as IL-12p40 and IL-6 production and B cell activation without affecting Ca2+ signaling. AS2795440 significantly reduces joint inflammation and bone loss in adjuvant-induced arthritis (AIA) mice model. AS2795440 can be used for inflammatory and autoimmune diseases like rheumatoid arthritis, psoriasis and inflammatory bowel disease research[1].

[2171506-45-7]

C29H32N6O

480.6

CC(NC1=C2N=C(C(NC3=C(N=CC(C4=CC=C(N=C4)C(CC5)=CCN5C(C)C)=C3)C)=O)C=C1)=C2C

Interleukin Related; MHC; PIKfyve

IL-23; IL-6; MHC II

Room temperature