AZD-CO-C2-Ph-amido-Ph-azide [CAS 1383544-71-5]

AZD-CO-C2-Ph-amido-Ph-azide is an alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs[1]. AZD-CO-C2-Ph-amido-Ph-azide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.

[1383544-71-5]

C19H17N5O3

363.37

O=C(C1=CC=C(C=C1)N=[N+]=[N-])NC2=CC=C(C=C2)CCC(N3CCC3=O)=O

PROTAC Linkers

Alkyl-Chain Linkers

10 mM in DMSO

Room temperature