Azide-C2-SS-C2-biotin [CAS 1620523-64-9]

Azide-C2-SS-C2-biotin is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs) [1]. Azide-C2-SS-C2-biotin is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.

[1620523-64-9]

C14H24N6O2S3

404.57

O=C(NCCSSCCN=[N+]=[N-])CCCC[C@@H]1SC[C@]([C@]1([H])N2)([H])NC2=O

ADC Linker

Cleavable Linker; Disulfide Cleavable Linker

99.84

10 mM in DMSO

-20°C, 3 years; 4°C, 2 years (Powder)

Room Temperature

H302, H315, H319, H335

H302, H315, H319, H335