Azide-PEG3-C1-Ala [CAS 2054345-67-2]

Azide-PEG3-C1-Ala is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Azide-PEG3-C1-Ala is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.

[2054345-67-2]

C9H18N4O5

262.26

N[C@H](COCCOCCOCCN=[N+]=[N-])C(O)=O

PROTAC Linkers

PEG Linkers

10 mM in DMSO

Room temperature