Azide-PEG3-Desthiobiotin [CAS 1426828-06-9]

Azide-PEG3-Desthiobiotin is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Azide-PEG3-Desthiobiotin is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.

[1426828-06-9]

C18H34N6O5

414.5

O=C(NCCOCCOCCOCCN=[N+]=[N-])CCCCC[C@H]([C@H](C)N1)NC1=O

PROTAC Linkers

PEG Linkers

96

DMSO : ≥ 100 mg/mL

-20°C, 3 years; 4°C, 2 years (Powder)

Room Temperature

H302, H315, H319, H335

H302, H315, H319, H335