Azide-PEG4-Desthiobiotin [CAS 3081529-39-4]

Azide-PEG4-Desthiobiotin is a PEG derivative consisting of desthiobiotin, 4 PEG unit, and an azide group. Biotin can form a stable non-covalent bond with streptavidin. It contains an azide group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing alkyne groups. It can also undergo ring strain-driven alkyne-azide cycloaddition (SPAAC) with molecules containing DBCO or BCN groups[1].

[3081529-39-4]

C20H38N6O6

458.55

O=C(NCCOCCOCCOCCOCCN=[N+]=[N-])CCCCC[C@H]([C@H](C)N1)NC1=O

Biochemical Assay Reagents

Room temperature