Azide-PEG5-Tos [CAS 236754-49-7]

Azide-PEG5-Tos is a cleavable 5 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs) [1]. Azide-PEG5-Tos is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.

[236754-49-7]

C17H27N3O7S

417.48

[N-]=[N+]=NCCOCCOCCOCCOCCOS(C1=CC=C(C)C=C1)(=O)=O

ADC Linker

Cleavable Linker

99.83

DMSO : ≥ 100 mg/mL

-20°C, 3 years; 4°C, 2 years (Powder)

Room Temperature

H302, H315, H319, H335

H302, H315, H319, H335