Azido-PEG3-DYKDDDDK [CAS 2243206-95-1]

Azido-PEG3-DYKDDDDK (azide-PEG3-FLAG) is a multifunctional fusion tag for the purification of recombinant proteins. Azido-PEG3-DYKDDDDK is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups[1].

[2243206-95-1]

C50H75N13O24

1242.2

OC(C=C1)=CC=C1C[C@H](NC([C@H](CC(O)=O)NC(CCOCCOCCOCCN=[N+]=[N-])=O)=O)C(N[C@@H](CCCCN)C(N[C@@H](CC(O)=O)C(N[C@@H](CC(O)=O)C(N[C@@H](CC(O)=O)C(N[C@@H](CC(O)=O)C(N[C@H](C(O)=O)CCCCN)=O)=O)=O)=O)=O)=O

Biochemical Assay Reagents

10 mM in DMSO

Room temperature