Azido-PEG3-MS [CAS 176520-24-4]

Azido-PEG3-MS is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Azido-PEG3-MS is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.

[176520-24-4]

C7H15N3O5S

253.28

[N-]=[N+]=NCCOCCOCCOS(C)(=O)=O

PROTAC Linkers

PEG Linkers

10 mM in DMSO

Room temperature