Azido-PEG4-Amido-Tris [CAS 1398044-55-7]

Azido-PEG4-Amido-Tris is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Azido-PEG4-Amido-Tris is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.

[1398044-55-7]

C15H30N4O8

394.42

O=C(NC(CO)(CO)CO)CCOCCOCCOCCOCCN=[N+]=[N-]

PROTAC Linkers

PEG Linkers

96.39

10 mM in DMSO

-20°C, 3 years; 4°C, 2 years (Powder)

Room Temperature

H302, H315, H319, H335

H302, H315, H319, H335