Azido-PEG6-CH2COOH [CAS 880129-82-8]

Azido-PEG6-CH2COOH is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Azido-PEG6-CH2COOH is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.

[880129-82-8]

C14H27N3O8

365.38

O=C(O)COCCOCCOCCOCCOCCOCCN=[N+]=[N-]

PROTAC Linkers

PEG Linkers

98

DMSO : 50 mg/mL (ultrasonic)

-20°C, 3 years; 4°C, 2 years (Powder)

Room Temperature

H302, H315, H319, H335

H302, H315, H319, H335