Azilsartan mepixetil (potassium) [CAS 2153458-32-1]

Azilsartan mepixetil potassium (QR-01019K) is the antagonist of angiotensin II receptor. Azilsartan mepixetil potassium has stronger and longer blood pressure effect, more abvious and longer lasting heart rate lowering effect and high safety. Azilsartan mepixetil potassium has the potential for the research of hypertension, chronic heart failure and diabetic nephropathy (extracted from patent CN107400122A) [1].

[2153458-32-1]

C36H33KN6O8

716.78

O=C(OC(C)OC(C1=CC=CC2=C1N(CC3=CC=C(C4=C(C5=NOC([N-]5)=O)C=CC=C4)C=C3)C(OCC)=N2)=O)OCC6=NC(C)=C(C)N=C6C.[K+]

Angiotensin Receptor

10 mM in DMSO

Room temperature