Baclofen-d4-1 [CAS 70155-52-1]

Baclofen-d4-1 is the deuterium labeled Baclofen. Baclofen, a lipophilic derivative of γ-aminobutyric acid (GABA), is an orally active, selective metabotropic GABAB receptor (GABABR) agonist. Baclofen mimics the action of GABA and produces slow presynaptic inhibition through the GABAB receptor. Baclofen has high blood brain barrier penetrance. Baclofen has the potential for muscle spasticity research[1][2][3].

[70155-52-1]

C10H8D4ClNO2

217.69

NC([2H])(C(C1=CC=C(C=C1)Cl)C([2H])(C(O)=O)[2H])[2H]

GABA Receptor; Isotope-Labeled Compounds

Room temperature