Benzoyl coenzyme A [CAS 6756-74-7]

Benzoyl coenzyme A (Benzoyl CoA) is A derivative of Coenzyme A (CoA) in which the mercaptan group of CoA binds to the benzoyl group. Benzoyl coenzyme A is involved in the catalytic reaction as a substrate for the acyl transfer reaction. Benzoyl coenzyme A is a versatile metabolic intermediate that can be used to reveal substrate specificity of enzymes, metabolic regulation, and drug metabolism[1].

[6756-74-7]

C28H40N7O17P3S

871.64

O[C@@H]1[C@H](OP(O)(O)=O)[C@H](O[C@H]1N2C(N=CN=C3N)=C3N=C2)COP(OP(OCC(C)(C)[C@@H](O)C(NCCC(NCCSC(C4=CC=CC=C4)=O)=O)=O)(O)=O)(O)=O

Endogenous Metabolite

Room temperature