Biotin-PEG-COOH (MW 5000)

Biotin-PEG-COOH (MW 5000) is a linear heterobifunctional PEG compound with biotin and carboxylic acid functional groups. Biotin can bind to avidin and streptavidin with high specificity and affinity. Biotin-PEG-COOH (MW 5000) can be used to biotin-label antibodies, proteins and other macromolecules containing primary amines in the presence of a condensing agent[1].

O=C(NCCOCC(O)=O)CCCC[C@@H]1SC[C@]([C@]1([H])N2)([H])NC2=O.[n]

Biochemical Assay Reagents

Room temperature