Biotin-PEG4-Dde-TAMRA-PEG3-Azide [CAS 2353409-56-8]

Biotin-PEG4-Dde-TAMRA-PEG3-Azide is a dye derivative of TAMRA modified with a cleavable biotin group. Biotin-PEG4-Dde-TAMRA-PEG3-Azide contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.

[2353409-56-8]

C69H96N12O17S

1397.64

[O-]C(C(C=C(C(NCCC(N(CCOCCOCCOCCN=[N+]=[N-])CCC(NCCCN/C(CCOCCOCCOCCOCCNC(CCCC[C@H]1[C@](NC2=O)([H])[C@](N2)([H])CS1)=O)=C(C3=O)\C(CC(C)(C)C3)=O)=O)=O)=O)C=C4)=C4C5=C(C=CC(N)=C6)C6=[O+]C7=C5C=CC(N(C)C)=C7)=O

Fluorescent Dye

Cleavable Linker

10 mM in DMSO

Room temperature