BRD-810 [CAS 2329719-65-3]

BRD-810 is a potent and selective MCL1 inhibitor with a Kd of 0.3 nM. BRD-810 can specifically block the BH3 binding groove of MCL1, while having little effect on other anti-apoptotic proteins (such as Bcl-2, Bcl-xL) . BRD-810 effectively destroys the MCL1-BAK complex (IC50 = 1.2 nM) in cancer cells, rapidly activates Caspase and induces cell apoptosis. BRD-810 can be used in the research of various cancers such as hematological tumors and solid tumors[1].

[2329719-65-3]

C39H44ClFN4O5

703.24

O=C(O)C(N1CCCCO[C@H](CCN2CCOCC2)C3=NN(C)C(CC)=C43)=C(CCCOC5=C6C(C=C(F)C=C6)=CC=C5)C7=C1C4=C(Cl)C=C7

Apoptosis; Bcl-2 Family; Caspase

Caspase 3; Mcl-1

98

DMSO : 100 mg/mL (ultrasonic)

-20°C, 3 years; 4°C, 2 years (Powder)

Room Temperature