Carbol fuchsin [CAS 4197-24-4]

Carbol fuchsin is a histological stain used in microbiology to distinguish acid-fast bacteria from non-acid-fast bacteria. It is a mixture of basic fuchsin, phenol, and water and is commonly used in the Ziehl-Neelsen staining technique for the detection of tuberculosis and other mycobacterial infections. Carbol fuchsin stains the cell walls of acid-fast bacteria bright red, while other cells are unstained or slightly stained. This makes it easier to see and identify these microbes under a microscope. Carbol fuchsin is also used in veterinary medicine and phytopathology for similar purposes.

[4197-24-4]

C21H22ClN3

351.87

N=C1C=C/C(C=C1)=C(C2=CC=C(C(C)=C2)N)/C3=CC=C(C(C)=C3)N.Cl

Biochemical Assay Reagents

10 mM in DMSO

Room temperature

H302-H314-H332-H341-H350-H373

P260-P261-P264-P270-P271-P280-P301+P330+P331-P304+P340-P330-P363-P405-P501