CIDD-8633 [CAS 1428356-95-9]

CIDD-8633 is a potent DDR2 inhibitor with an IC50 of 6.105 μM. CIDD-8633 inhibits cell migration and halts the cell cycle and induces apoptosis, significantly suppressing pancreatic ductal adenocarcinoma (PDAC) tumor growth. CIDD-8633 can be used for the study of pancreatic cancer such as PDAC[1].

[1428356-95-9]

C22H23N9O2

445.48

O=C(NC1=CC=C(NC2=NC(NCC)=NC(C)=C2)C=C1)COC(C=C3)=NN=C3N4C=CC=N4

Apoptosis; Caspase; Discoidin Domain Receptor; Interleukin Related; PERK

Caspase 3; DDR2; IL-6

Room temperature