Cis-V-11-0711 [CAS 1428338-79-7]

Cis-V-11-0711 is the cis form of V-11-0711. V-11-0711 is a potent and selective Chk-α (IC50 = 20 nM) inhibitor. V-11-0711 can significantly reduce PCho levels. V-11-0711 causes a reversible growth arrest. V-11-0711 induces apoptosis at high concentrations. V-11-0711 can be used for the study of cervical cancer and triple-negative breast cancer[1][2].

[1428338-79-7]

C27H35NO3

421.57

O[C@]([C@]1([H])C2CCN(CC2)C1)(C3=CC=CC=C3)CCC4=C(C=CC=C4)OC5CCOCC5

Apoptosis; Choline Kinase; Drug Isomer

Room temperature