CLA [CAS 19953-58-3]

CLA, or conjugated linoleic acid, is a polyunsaturated fatty acid that occurs naturally in a variety of animal products, such as meat and dairy. It has several potential benefits for human health, including the ability to reduce body fat mass, improve insulin sensitivity, and reduce inflammation. CLA has been extensively studied for its effects on weight loss and muscle growth, as well as its potential role in preventing chronic diseases such as heart disease and cancer. Additionally, it can be taken as a dietary supplement in capsule form.

[19953-58-3]

C13H11N3O

225.25

CC1=NC2=CNC(=CN2C1=O)C3=CC=CC=C3

Biochemical Assay Reagents

10 mM in DMSO

Room temperature

H302-H315-H319-H335

P261-P264-P270-P271-P280-P302+P352-P304+P340-P330-P362+P364-P405-P501