CP-394531 [CAS 305822-63-3]

CP-394531 is an efficient and highly selective non-steroidal glucocorticoid receptor (GR) antagonist, with a Ki value of 0.1 nM. CP-394531 has a weak binding to androgen receptor (AR) (Ki = 130 nM), and has almost no effect on progesterone receptor (PR) and estrogen receptors (ERα, ERβ). CP-394531 completely blocks the half-maximal agonistic effect induced by Dexamethasone , with a Kif of 4.1 nM. CP-394531 can be used to study various diseases such as diabetes, obesity, depression, neurodegenerative diseases, glaucoma and Cushing's disease[1].

[305822-63-3]

C23H23ClO2

366.88

O[C@@]1(C#CCl)C[C@@]2([H])CCC3=C(C=CC(O)=C3)[C@]2(CC4=CC=CC=C4)CC1

Androgen Receptor; Glucocorticoid Receptor

Room temperature