Cy3-PEG-NH2 (MW 3400)

Cy3-PEG-NH2 (MW 3400) is a polyethylene glycol derivative containing Cy3 fluorescent dye and polyethylene glycol (PEG) and an amino group. The Cy3 fluorophore is commonly used in applications such as immunolabeling, nucleic acid labeling, fluorescence microscopy, and flow cytometry. Cy3 has an emission maximum around 562-570 nm. Cy3-PEG-NH2 (MW 3400) can be used for fluorescence imaging, fluorescence tracing and fluorescence labeling[1].

CC(C1=CC=C(S(=O)(O)=O)C=C1N/2CCCCCC(NCCOCCN)=O)(C)C2=C\C=C\C3=[N+](CC)C4=C(C=C(S(=O)([O-])=O)C=C4)C3(C)C.[n]

Fluorescent Dye

Room temperature