Cy5.5-PEG-NH2 (MW 5000)

Cy5.5-PEG-NH2 (MW 5000) is a polyethylene glycol derivative containing Cy5.5 fluorescent dye and polyethylene glycol (PEG) and an amino group. The Cy5.5 fluorophore is commonly used in applications such as immunolabeling, nucleic acid labeling, fluorescence microscopy, and flow cytometry. Cy5.5 has an emission maximum around 710 nm. Cy5.5-PEG-NH2 (MW 5000) can be used for fluorescence imaging, fluorescence tracing and fluorescence labeling.

CC(/C(N1CCCCCC(NCCOCCN)=O)=C/C=C/C=C/C2=[N+](CC)C3=C(C=C(C=CC=C4)C4=C3)C2(C)C)(C)C(C1=C5)=CC6=C5C=CC=C6.[Cl-].[n]

Fluorescent Dye

Room temperature