Cy5-PEG-N3 (MW 3400)

Cy5-PEG-N3 (MW 3400) is a Cy5 -azide fluorescent dye used to label for protein and nucleic acid. Cy5-PEG-N3 (MW 3400) is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.

CC(C1=CC=C(S(=O)(O)=O)C=C1N/2CCCCCC(NCCOCCN=[N+]=[N-])=O)(C)C2=C\C=C\C=C\C3=[N+](CC)C4=C(C=CC(S(=O)([O-])=O)=C4)C3(C)C.[n]

Fluorescent Dye

Room temperature