Cy7.5 PEG-SH

Cy7.5 PEG-SH is a fluorescent labeling reagent that combines CY7.5 fluorescent dye, polyethylene glycol (PEG) and sulfhydryl (SH) derivatives, and is suitable for molecular coupling. SH is highly reactive and can react with a variety of functional groups (such as maleimide) to form stable thioether bonds (Ex/Em = 770/820 nm).

CC1(C)C(/C=C/C=C/C=C/C=C2C(C)(C)C(C(C=CC=C3)=C3C=C4)=C4N/2CCCCCC(NCCOCCS)=O)=[N+](C)C5=C1C(C=CC=C6)=C6C=C5.[n]

Fluorescent Dye

Room temperature