D-Galactal [CAS 21193-75-9]

D-Galactal is a monosaccharide that belongs to the class of carbohydrates. It is an aldohexose, which means it has six carbon atoms and an aldehyde functional group. D-Galactal occurs naturally in certain foods such as dairy products, meats and fruits. It can also be synthesized by chemical or enzymatic processes. D-Galactal has various applications in the food industry, especially as a flavoring and sweetening agent. Additionally, it has potential research roles in metabolic disorders, cancer, and inflammation.

[21193-75-9]

C6H10O4

146.14

O[C@@H]1C=CO[C@H](CO)[C@@H]1O

Biochemical Assay Reagents

95

10 mM in DMSO

-20°C, 3 years; 4°C, 2 years (Powder)

Room Temperature

H315, H319, H335

H315, H319, H335