α-D-Galactofuranose,1,2-O- (1-methylethylidene),3-acetate [CAS 109680-96-8]

α-D-Galactofuranose,1,2-O- (1-methylethylidene),3-acetate is a class of biochemical reagents used in glycobiology research. Glycobiology studies the structure, synthesis, biology, and evolution of sugars. It involves carbohydrate chemistry, enzymology of glycan formation and degradation, protein-glycan recognition, and the role of glycans in biological systems. This field is closely related to basic research, biomedicine, and biotechnology[1].

[109680-96-8]

C11H18O7

262.26

CC(O[C@@H]1[C@]2([H])[C@](OC(C)(O2)C)([H])O[C@@]1([H])[C@H](O)CO)=O

Biochemical Assay Reagents

Room temperature