β-D-Mannopyranoside, octyl,2,3,4,6-tetraacetate [CAS 128299-96-7]

β-D-Mannopyranoside, octyl,2,3,4,6-tetraacetate is a class of biochemical reagents used in glycobiology research. Glycobiology studies the structure, synthesis, biology, and evolution of sugars. It involves carbohydrate chemistry, enzymology of glycan formation and degradation, protein-glycan recognition, and the role of glycans in biological systems. This field is closely related to basic research, biomedicine, and biotechnology[1].

[128299-96-7]

C22H36O10

460.52

CC(O[C@H]1[C@@H]([C@H](O[C@H]([C@H]1OC(C)=O)OCCCCCCCC)COC(C)=O)OC(C)=O)=O

Biochemical Assay Reagents

Room temperature