DBCO-PEG12-TCO [CAS 2055022-06-3]

DBCO-PEG12-TCO cantains a TCO and a DBCO moiety. TCO group can specifically react with terrahydrazine. DBCO-PEG12-TCO is a click chemistry reagent, it contains a DBCO group that can undergo strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing Azide groups. DBCO-PEG12-TCO also contains a TCO group that can undergo an inverse electron demand Diels-Alder reaction (iEDDA) with molecules containing Tetrazine groups.

[2055022-06-3]

C54H81N3O16

1028.23

O=C(OC1CC/C=C/CCC1)NCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCC(NCCC(N2C3=CC=CC=C3C#CC4=CC=CC=C4C2)=O)=O

Fluorescent Dye

95

10 mM in DMSO

-20°C (Powder, protect from light)

Blue Ice

H302, H315, H319, H335

H302, H315, H319, H335