DBCO-PEG4-Biotin [CAS 1255942-07-4]

DBCO-PEG4-Biotin is an azadibenzocyclooctyne-biotin derivative containing a biotin group and 4 PEGs. DBCO-PEG4-Biotin is a versatile biotinylation reagent used for the introduction of a biotin moiety to azide-labeled biomolecules via copper-free strain-promoted alkyne-azide click chemistry (SPAAC) reaction[1]. DBCO-PEG4-Biotin is a click chemistry reagent, it contains a DBCO group that can undergo strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing Azide groups.

[1255942-07-4]

C39H51N5O8S

749.92

O=C(NCCOCCOCCOCCOCCC(NCCC(N1C2=CC=CC=C2C#CC3=CC=CC=C3C1)=O)=O)CCCC[C@@H]4SC[C@]([C@]4([H])N5)([H])NC5=O

Biochemical Assay Reagents

99.49

DMSO : 100 mg/mL (ultrasonic)

4°C (Powder, sealed storage, away from moisture)

Room Temperature

H302, H315, H319, H335

H302, H315, H319, H335