Deoxycorticosterone 21-glucoside [CAS 4319-56-6]

Deoxycorticosterone 21-glucoside is a class of biochemical reagents used in glycobiology research. Glycobiology studies the structure, synthesis, biology, and evolution of sugars. It involves carbohydrate chemistry, enzymology of glycan formation and degradation, protein-glycan recognition, and the role of glycans in biological systems. This field is closely related to basic research, biomedicine, and biotechnology[1].

[4319-56-6]

C27H40O8

492.6

C[C@@]12[C@](CC[C@@H]2C(CO[C@@H]3O[C@@H]([C@H]([C@@H]([C@H]3O)O)O)CO)=O)([H])[C@@]4([H])[C@@](CC1)([H])[C@@]5(C(CC4)=CC(CC5)=O)C

Biochemical Assay Reagents

Room temperature