DNP-PEG2-azide

DNP-PEG2-azide is a PEG derivative that can be used for drug delivery and other research. DNP-PEG2-azide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups[1].

C12H16N6O6

340.29

[N-]=[N+]=NCCOCCOCCNC1=CC=C(C=C1[N+]([O-])=O)[N+]([O-])=O

Biochemical Assay Reagents

Room temperature