DNP-PEG3-azide [CAS 951671-87-7]

DNP-PEG3-azide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. DNP-PEG3-azide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.

[951671-87-7]

C14H20N6O7

384.34

O=[N+](C1=CC=C(NCCOCCOCCOCCN=[N+]=[N-])C([N+]([O-])=O)=C1)[O-]

PROTAC Linkers

PEG Linkers

99.18

DMSO : 100 mg/mL (ultrasonic)

-20°C, 3 years; 4°C, 2 years (Powder)

Room Temperature

H302, H315, H319, H335

H302, H315, H319, H335