DOCP [CAS 1360461-57-9]

DOCP (2- ((2,3-Bis (oleoyloxy) propyl) dimethylammonio) ethyl hydrogen phosphate), characterized by their inverted charge orientation compared to traditional phosphocholine (PC) lipids, feature a quaternary amine positioned near the bilayer interface and a phosphate group that protrudes into the aqueous environment. This unique configuration of iPC lipids provides an exceptional opportunity to explore the biophysical properties and bioactivity implications resulting from the charge inversion at the bilayer surface.

[1360461-57-9]

C43H82NO8P

772.09

O=P([O-])(O)OCC[N+](C)(C)CC(COC(CCCCCCC/C=C\CCCCCCCC)=O)OC(CCCCCCC/C=C\CCCCCCCC)=O

Endogenous Metabolite

Room temperature