DOTA-GA-maleimide [CAS 1800229-46-2]

DOTA-GA-maleimide is a bifunctional chelator containing a DOTA macrocycle chelator, a GA linker, and a maleimide reactive group. DOTA-GA-maleimide can achieve radiolabeling of proteins by forming a stable coordination complex between the DOTA macrocycle and radioactive metal ions (such as 111In) through the specific binding of maleimide to protein thiol groups. DOTA-GA-maleimide can be used for SPECT imaging studies of MMP activity-related cancers[1][2].

[1800229-46-2]

C25H38N6O11

598.6

O=C(CN1CCN(CCN(C(CCC(NCCN2C(C=CC2=O)=O)=O)C(O)=O)CCN(CC1)CC(O)=O)CC(O)=O)O

Biochemical Assay Reagents; MMP; Radionuclide-Drug Conjugates (RDCs)

RDC Bifunctional Chelator

99.79

H2O : 250 mg/mL (ultrasonic)

-20°C (Powder, protect from light)

Blue Ice